C18H23FN2O3S — CID 56877501
2-(1,1-dioxothiolan-3-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide (PubChem CID 56877501) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 56877501 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide |
| SMILES | CCc1[nH]c2c(CNC(=O)CC3CCS(=O)(=O)C3)cc(F)cc2c1C |
| InChI | InChI=1S/C18H23FN2O3S/c1-3-16-11(2)15-8-14(19)7-13(18(15)21-16)9-20-17(22)6-12-4-5-25(23,24)10-12/h7-8,12,21H,3-6,9-10H2,1-2H3,(H,20,22) |
| InChIKey | QAXFTIRBCKREGO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|