C21H31N3O2 — CID 95551283
(3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(2-methoxyethyl)pyrrolidine-3-carboxamide (PubChem CID 95551283) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(2-methoxyethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(2-methoxyethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95551283 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(2-methoxyethyl)pyrrolidine-3-carboxamide |
| SMILES | CCc1[nH]c2c(CNC(=O)[C@H]3CCN(CCOC)C3)cc(C)cc2c1C |
| InChI | InChI=1S/C21H31N3O2/c1-5-19-15(3)18-11-14(2)10-17(20(18)23-19)12-22-21(25)16-6-7-24(13-16)8-9-26-4/h10-11,16,23H,5-9,12-13H2,1-4H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | RZBOVZDSJKXASG-INIZCTEOSA-N |
| XLogP | 2.93 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|