C24H28N4O2 — CID 45251005
3-N-[(3,5-dimethyl-2-phenyl-1H-indol-7-yl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 45251005) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-N-[(3,5-dimethyl-2-phenyl-1H-indol-7-yl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[(3,5-dimethyl-2-phenyl-1H-indol-7-yl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 45251005 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-N-[(3,5-dimethyl-2-phenyl-1H-indol-7-yl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)C2CCCN(C(N)=O)C2)c2[nH]c(-c3ccccc3)c(C)c2c1 |
| InChI | InChI=1S/C24H28N4O2/c1-15-11-19(13-26-23(29)18-9-6-10-28(14-18)24(25)30)22-20(12-15)16(2)21(27-22)17-7-4-3-5-8-17/h3-5,7-8,11-12,18,27H,6,9-10,13-14H2,1-2H3,(H2,25,30)(H,26,29) |
| InChIKey | NILLKUNUHFCTAZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |