C19H24N2O2 — CID 1166452
(2-ethyl-3,6,8-trimethylquinolin-4-yl)-morpholin-4-ylmethanone (PubChem CID 1166452) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2-ethyl-3,6,8-trimethylquinolin-4-yl)-morpholin-4-ylmethanone.
| Compound Name | (2-ethyl-3,6,8-trimethylquinolin-4-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 1166452 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2-ethyl-3,6,8-trimethylquinolin-4-yl)-morpholin-4-ylmethanone |
| SMILES | CCc1nc2c(C)cc(C)cc2c(C(=O)N2CCOCC2)c1C |
| InChI | InChI=1S/C19H24N2O2/c1-5-16-14(4)17(19(22)21-6-8-23-9-7-21)15-11-12(2)10-13(3)18(15)20-16/h10-11H,5-9H2,1-4H3 |
| InChIKey | WUGYHZWPAGRPPP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |