C21H28ClN5O — CID 120928380
4-pyrazol-1-yl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120928380) has the molecular formula C21H28ClN5O and a molecular weight of 401.94 g/mol. Its IUPAC name is 4-pyrazol-1-yl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-pyrazol-1-yl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120928380 |
| Molecular Formula | C21H28ClN5O |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-pyrazol-1-yl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1cc(CNC(=O)C2(n3cccn3)CCNCC2)c2[nH]c(C)c(C)c2c1.Cl |
| InChI | InChI=1S/C21H27N5O.ClH/c1-14-11-17(19-18(12-14)15(2)16(3)25-19)13-23-20(27)21(5-8-22-9-6-21)26-10-4-7-24-26;/h4,7,10-12,22,25H,5-6,8-9,13H2,1-3H3,(H,23,27);1H |
| InChIKey | XYRSFHSOBKZFDQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|