C13H22N2O5S — CID 95126849
N-[(3S)-2-oxoazepan-3-yl]-2-[[(2R)-oxolan-2-yl]methylsulfonyl]acetamide (PubChem CID 95126849) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[(3S)-2-oxoazepan-3-yl]-2-[[(2R)-oxolan-2-yl]methylsulfonyl]acetamide.
| Compound Name | N-[(3S)-2-oxoazepan-3-yl]-2-[[(2R)-oxolan-2-yl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 95126849 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[(3S)-2-oxoazepan-3-yl]-2-[[(2R)-oxolan-2-yl]methylsulfonyl]acetamide |
| SMILES | O=C(CS(=O)(=O)C[C@H]1CCCO1)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C13H22N2O5S/c16-12(15-11-5-1-2-6-14-13(11)17)9-21(18,19)8-10-4-3-7-20-10/h10-11H,1-9H2,(H,14,17)(H,15,16)/t10-,11+/m1/s1 |
| InChIKey | RCSYYQLGFKFEHA-MNOVXSKESA-N |
| XLogP | -0.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |