C18H24ClN3O — CID 95127679
1-[(2R)-2-[1-[(6-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone (PubChem CID 95127679) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 1-[(2R)-2-[1-[(6-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[1-[(6-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95127679 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[(2R)-2-[1-[(6-chloro-3-pyridinyl)methyl]-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC[C@@H]1C1=CCCN(Cc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C18H24ClN3O/c1-14(23)22-10-3-2-6-17(22)16-5-4-9-21(13-16)12-15-7-8-18(19)20-11-15/h5,7-8,11,17H,2-4,6,9-10,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | GHVNIKLVWRLQHV-QGZVFWFLSA-N |
| XLogP | 3.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|