C21H30N2O — CID 95141511
1-[(2R)-2-[1-(3-phenylpropyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone (PubChem CID 95141511) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 1-[(2R)-2-[1-(3-phenylpropyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[1-(3-phenylpropyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95141511 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-[(2R)-2-[1-(3-phenylpropyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC[C@@H]1C1=CCCN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2O/c1-18(24)23-16-6-5-13-21(23)20-12-8-15-22(17-20)14-7-11-19-9-3-2-4-10-19/h2-4,9-10,12,21H,5-8,11,13-17H2,1H3/t21-/m1/s1 |
| InChIKey | QIFDKOFUEIJTHG-OAQYLSRUSA-N |
| XLogP | 3.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|