C20H27N3O2 — CID 95230024
2-[5-[(2S)-1-(2-phenylacetyl)piperidin-2-yl]-3,6-dihydro-2H-pyridin-1-yl]acetamide (PubChem CID 95230024) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[5-[(2S)-1-(2-phenylacetyl)piperidin-2-yl]-3,6-dihydro-2H-pyridin-1-yl]acetamide.
| Compound Name | 2-[5-[(2S)-1-(2-phenylacetyl)piperidin-2-yl]-3,6-dihydro-2H-pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 95230024 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-[5-[(2S)-1-(2-phenylacetyl)piperidin-2-yl]-3,6-dihydro-2H-pyridin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC=C([C@@H]2CCCCN2C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O2/c21-19(24)15-22-11-6-9-17(14-22)18-10-4-5-12-23(18)20(25)13-16-7-2-1-3-8-16/h1-3,7-9,18H,4-6,10-15H2,(H2,21,24)/t18-/m0/s1 |
| InChIKey | JAHJGHIQYZQGFG-SFHVURJKSA-N |
| XLogP | 1.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|