C18H23N3 — CID 95128968
N'-pyridin-3-yl-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diamine (PubChem CID 95128968) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N'-pyridin-3-yl-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diamine.
| Compound Name | N'-pyridin-3-yl-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 95128968 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N'-pyridin-3-yl-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,3-diamine |
| SMILES | c1cncc(NCCCN[C@H]2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H23N3/c1-2-6-16-13-17(9-8-15(16)5-1)20-11-4-12-21-18-7-3-10-19-14-18/h1-3,5-7,10,14,17,20-21H,4,8-9,11-13H2/t17-/m0/s1 |
| InChIKey | BZJIXHZCQFFFAY-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|