C17H21N5O2 — CID 95130541
1-[(1S)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 95130541) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[(1S)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-[(1S)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 95130541 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[(1S)-1-(2-oxo-1,3-dihydroindol-5-yl)ethyl]-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | C[C@H](NC(=O)NCCCn1cccn1)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C17H21N5O2/c1-12(13-4-5-15-14(10-13)11-16(23)21-15)20-17(24)18-6-2-8-22-9-3-7-19-22/h3-5,7,9-10,12H,2,6,8,11H2,1H3,(H,21,23)(H2,18,20,24)/t12-/m0/s1 |
| InChIKey | SFYQWWKOZJYBPP-LBPRGKRZSA-N |
| XLogP | 1.83 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|