C13H19N3O3 — CID 95132102
(2R)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 95132102) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2R)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95132102 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (2R)-N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN(C)[C@@H](CNC(=O)[C@H]1CCC(=O)N1)c1ccco1 |
| InChI | InChI=1S/C13H19N3O3/c1-16(2)10(11-4-3-7-19-11)8-14-13(18)9-5-6-12(17)15-9/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,14,18)(H,15,17)/t9-,10+/m1/s1 |
| InChIKey | LQDAQJNCXGLHEV-ZJUUUORDSA-N |
| XLogP | 0.28 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |