C9H16N2O4 — CID 110462101
N-(2,2-dimethoxyethyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 110462101) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110462101 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | COC(CNC(=O)C1CCC(=O)N1)OC |
| InChI | InChI=1S/C9H16N2O4/c1-14-8(15-2)5-10-9(13)6-3-4-7(12)11-6/h6,8H,3-5H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | WVYXHBFVXUKVIZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|