C16H21FN2O3S — CID 95132352
2-[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 95132352) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 95132352 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]-prop-2-enylamino]-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)NCc1ccccc1F)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21FN2O3S/c1-2-8-19(14-7-9-23(21,22)12-14)11-16(20)18-10-13-5-3-4-6-15(13)17/h2-6,14H,1,7-12H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | WJNDFVLGFKEFFC-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|