C18H19N3O3S — CID 95132831
methyl N-[(4S)-2-oxo-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,4-dihydro-1H-quinolin-7-yl]carbamate (PubChem CID 95132831) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is methyl N-[(4S)-2-oxo-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,4-dihydro-1H-quinolin-7-yl]carbamate.
| Compound Name | methyl N-[(4S)-2-oxo-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,4-dihydro-1H-quinolin-7-yl]carbamate |
|---|---|
| PubChem CID | 95132831 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl N-[(4S)-2-oxo-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3,4-dihydro-1H-quinolin-7-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)C[C@@H]2c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H19N3O3S/c1-24-18(23)19-10-6-7-11-12(9-16(22)20-14(11)8-10)17-21-13-4-2-3-5-15(13)25-17/h6-8,12H,2-5,9H2,1H3,(H,19,23)(H,20,22)/t12-/m0/s1 |
| InChIKey | YXOJFRRTFGDXKJ-LBPRGKRZSA-N |
| XLogP | 3.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |