C19H19N5O2 — CID 95136208
N-[3-(benzotriazol-1-yl)propyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide (PubChem CID 95136208) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[3-(benzotriazol-1-yl)propyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide.
| Compound Name | N-[3-(benzotriazol-1-yl)propyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 95136208 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[3-(benzotriazol-1-yl)propyl]-2-[(1S)-3-oxo-1,2-dihydroisoindol-1-yl]acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)c2ccccc21)NCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C19H19N5O2/c25-18(12-16-13-6-1-2-7-14(13)19(26)21-16)20-10-5-11-24-17-9-4-3-8-15(17)22-23-24/h1-4,6-9,16H,5,10-12H2,(H,20,25)(H,21,26)/t16-/m0/s1 |
| InChIKey | SLSSFSHDULCCDK-INIZCTEOSA-N |
| XLogP | 1.81 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|