C18H16N2O3 — CID 95136327
(3R)-5-oxo-1-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 95136327) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (3R)-5-oxo-1-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-5-oxo-1-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95136327 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (3R)-5-oxo-1-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(=O)N(c2cccc(/C=C/c3ccccn3)c2)C1 |
| InChI | InChI=1S/C18H16N2O3/c21-17-11-14(18(22)23)12-20(17)16-6-3-4-13(10-16)7-8-15-5-1-2-9-19-15/h1-10,14H,11-12H2,(H,22,23)/b8-7+/t14-/m1/s1 |
| InChIKey | NTUCVGLWHFCMJC-HSBSLETESA-N |
| XLogP | 2.69 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |