C15H22N4O3S — CID 95137115
5,5-dimethyl-3-[2-[(2S)-2-(4-methyl-1,3-thiazol-2-yl)morpholin-4-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 95137115) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[(2S)-2-(4-methyl-1,3-thiazol-2-yl)morpholin-4-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[(2S)-2-(4-methyl-1,3-thiazol-2-yl)morpholin-4-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95137115 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5,5-dimethyl-3-[2-[(2S)-2-(4-methyl-1,3-thiazol-2-yl)morpholin-4-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1csc([C@@H]2CN(CCN3C(=O)NC(C)(C)C3=O)CCO2)n1 |
| InChI | InChI=1S/C15H22N4O3S/c1-10-9-23-12(16-10)11-8-18(6-7-22-11)4-5-19-13(20)15(2,3)17-14(19)21/h9,11H,4-8H2,1-3H3,(H,17,21)/t11-/m0/s1 |
| InChIKey | PCHAILXOMZUUCG-NSHDSACASA-N |
| XLogP | 1.16 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|