C16H25N5O3 — CID 95285040
5,5-dimethyl-3-[2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 95285040) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95285040 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 5,5-dimethyl-3-[2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cnn(C[C@@H]2CN(CCN3C(=O)NC(C)(C)C3=O)CCO2)c1 |
| InChI | InChI=1S/C16H25N5O3/c1-12-8-17-20(9-12)11-13-10-19(6-7-24-13)4-5-21-14(22)16(2,3)18-15(21)23/h8-9,13H,4-7,10-11H2,1-3H3,(H,18,23)/t13-/m0/s1 |
| InChIKey | GRRPSJPGFUTAKP-ZDUSSCGKSA-N |
| XLogP | 0.22 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|