C15H25N7O — CID 95287030
(2R)-4-[(1-butyltetrazol-5-yl)methyl]-2-[(4-methylpyrazol-1-yl)methyl]morpholine (PubChem CID 95287030) has the molecular formula C15H25N7O and a molecular weight of 319.41 g/mol. Its IUPAC name is (2R)-4-[(1-butyltetrazol-5-yl)methyl]-2-[(4-methylpyrazol-1-yl)methyl]morpholine.
| Compound Name | (2R)-4-[(1-butyltetrazol-5-yl)methyl]-2-[(4-methylpyrazol-1-yl)methyl]morpholine |
|---|---|
| PubChem CID | 95287030 |
| Molecular Formula | C15H25N7O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (2R)-4-[(1-butyltetrazol-5-yl)methyl]-2-[(4-methylpyrazol-1-yl)methyl]morpholine |
| SMILES | CCCCn1nnnc1CN1CCO[C@@H](Cn2cc(C)cn2)C1 |
| InChI | InChI=1S/C15H25N7O/c1-3-4-5-22-15(17-18-19-22)12-20-6-7-23-14(10-20)11-21-9-13(2)8-16-21/h8-9,14H,3-7,10-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | XZSRWZOICXWSDM-CQSZACIVSA-N |
| XLogP | 0.88 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |