C15H25N7 — CID 86773540
1-[(1-butyltetrazol-5-yl)methyl]-4-(1-methylpyrazol-4-yl)piperidine (PubChem CID 86773540) has the molecular formula C15H25N7 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(1-butyltetrazol-5-yl)methyl]-4-(1-methylpyrazol-4-yl)piperidine.
| Compound Name | 1-[(1-butyltetrazol-5-yl)methyl]-4-(1-methylpyrazol-4-yl)piperidine |
|---|---|
| PubChem CID | 86773540 |
| Molecular Formula | C15H25N7 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[(1-butyltetrazol-5-yl)methyl]-4-(1-methylpyrazol-4-yl)piperidine |
| SMILES | CCCCn1nnnc1CN1CCC(c2cnn(C)c2)CC1 |
| InChI | InChI=1S/C15H25N7/c1-3-4-7-22-15(17-18-19-22)12-21-8-5-13(6-9-21)14-10-16-20(2)11-14/h10-11,13H,3-9,12H2,1-2H3 |
| InChIKey | UCGIWVBPYGKNDJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |