C13H20N4O5 — CID 95142888
ethyl 3-[[(9aR)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carbonyl]amino]propanoate (PubChem CID 95142888) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 3-[[(9aR)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(9aR)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 95142888 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ethyl 3-[[(9aR)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)N1CCN2C(=O)CNC(=O)[C@H]2C1 |
| InChI | InChI=1S/C13H20N4O5/c1-2-22-11(19)3-4-14-13(21)16-5-6-17-9(8-16)12(20)15-7-10(17)18/h9H,2-8H2,1H3,(H,14,21)(H,15,20)/t9-/m1/s1 |
| InChIKey | HGTTYAATSAGVLW-SECBINFHSA-N |
| XLogP | -1.71 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |