C16H23NO4S — CID 95143298
1-(methoxymethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclobutane-1-carboxamide (PubChem CID 95143298) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-(methoxymethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(methoxymethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 95143298 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-(methoxymethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclobutane-1-carboxamide |
| SMILES | COCC1(C(=O)N[C@@H](C)c2ccc(S(C)(=O)=O)cc2)CCC1 |
| InChI | InChI=1S/C16H23NO4S/c1-12(13-5-7-14(8-6-13)22(3,19)20)17-15(18)16(11-21-2)9-4-10-16/h5-8,12H,4,9-11H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | BKHJFUOCAKPMNE-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |