C17H30N4O2 — CID 95144268
[(3S)-1-[2-[3-methyl-4-(morpholin-4-ylmethyl)pyrazol-1-yl]ethyl]piperidin-3-yl]methanol (PubChem CID 95144268) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(3S)-1-[2-[3-methyl-4-(morpholin-4-ylmethyl)pyrazol-1-yl]ethyl]piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[2-[3-methyl-4-(morpholin-4-ylmethyl)pyrazol-1-yl]ethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 95144268 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | [(3S)-1-[2-[3-methyl-4-(morpholin-4-ylmethyl)pyrazol-1-yl]ethyl]piperidin-3-yl]methanol |
| SMILES | Cc1nn(CCN2CCC[C@H](CO)C2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C17H30N4O2/c1-15-17(12-20-7-9-23-10-8-20)13-21(18-15)6-5-19-4-2-3-16(11-19)14-22/h13,16,22H,2-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | XTNFMQKPGDKNLZ-INIZCTEOSA-N |
| XLogP | 0.73 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |