C20H35N5 — CID 95126139
1-[2-[3-methyl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]pyrazol-1-yl]ethyl]-4-prop-2-enylpiperazine (PubChem CID 95126139) has the molecular formula C20H35N5 and a molecular weight of 345.54 g/mol. Its IUPAC name is 1-[2-[3-methyl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]pyrazol-1-yl]ethyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[2-[3-methyl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]pyrazol-1-yl]ethyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 95126139 |
| Molecular Formula | C20H35N5 |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 345.29 |
| IUPAC Name | 1-[2-[3-methyl-4-[[(3R)-3-methylpiperidin-1-yl]methyl]pyrazol-1-yl]ethyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN(CCn2cc(CN3CCC[C@@H](C)C3)c(C)n2)CC1 |
| InChI | InChI=1S/C20H35N5/c1-4-7-22-9-11-23(12-10-22)13-14-25-17-20(19(3)21-25)16-24-8-5-6-18(2)15-24/h4,17-18H,1,5-16H2,2-3H3/t18-/m1/s1 |
| InChIKey | MGOMUFJRZKUFIH-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|