C17H26ClN3O — CID 95146929
(2R)-2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]-N-ethylpropanamide (PubChem CID 95146929) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is (2R)-2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]-N-ethylpropanamide.
| Compound Name | (2R)-2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 95146929 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (2R)-2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)NC1CCN(c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H26ClN3O/c1-4-19-17(22)13(3)20-14-7-9-21(10-8-14)15-6-5-12(2)16(18)11-15/h5-6,11,13-14,20H,4,7-10H2,1-3H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | BGWSZCNXIMQPKU-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |