C20H21N5OS — CID 95147942
(3S)-3-[5-(2-ethylsulfanylpyrimidin-5-yl)-4-phenylimidazol-1-yl]-1-methylpyrrolidin-2-one (PubChem CID 95147942) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (3S)-3-[5-(2-ethylsulfanylpyrimidin-5-yl)-4-phenylimidazol-1-yl]-1-methylpyrrolidin-2-one.
| Compound Name | (3S)-3-[5-(2-ethylsulfanylpyrimidin-5-yl)-4-phenylimidazol-1-yl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 95147942 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (3S)-3-[5-(2-ethylsulfanylpyrimidin-5-yl)-4-phenylimidazol-1-yl]-1-methylpyrrolidin-2-one |
| SMILES | CCSc1ncc(-c2c(-c3ccccc3)ncn2[C@H]2CCN(C)C2=O)cn1 |
| InChI | InChI=1S/C20H21N5OS/c1-3-27-20-21-11-15(12-22-20)18-17(14-7-5-4-6-8-14)23-13-25(18)16-9-10-24(2)19(16)26/h4-8,11-13,16H,3,9-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | YJISJUXEJOYTCH-INIZCTEOSA-N |
| XLogP | 3.52 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |