C19H20N6OS — CID 95148488
(8S)-2-pyrrolidin-1-yl-8-[4-(1,2,4-triazol-1-yl)phenyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one (PubChem CID 95148488) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is (8S)-2-pyrrolidin-1-yl-8-[4-(1,2,4-triazol-1-yl)phenyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one.
| Compound Name | (8S)-2-pyrrolidin-1-yl-8-[4-(1,2,4-triazol-1-yl)phenyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one |
|---|---|
| PubChem CID | 95148488 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (8S)-2-pyrrolidin-1-yl-8-[4-(1,2,4-triazol-1-yl)phenyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one |
| SMILES | O=C1C[C@@H](c2ccc(-n3cncn3)cc2)c2sc(N3CCCC3)nc2CN1 |
| InChI | InChI=1S/C19H20N6OS/c26-17-9-15(13-3-5-14(6-4-13)25-12-20-11-22-25)18-16(10-21-17)23-19(27-18)24-7-1-2-8-24/h3-6,11-12,15H,1-2,7-10H2,(H,21,26)/t15-/m0/s1 |
| InChIKey | JIHBJZQUQWTNEP-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |