C18H26N4O3 — CID 95149907
(2R)-1-[1-(2-ethoxypyridine-3-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 95149907) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R)-1-[1-(2-ethoxypyridine-3-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[1-(2-ethoxypyridine-3-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95149907 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2R)-1-[1-(2-ethoxypyridine-3-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | CCOc1ncccc1C(=O)N1CCC(N2CCC[C@@H]2C(N)=O)CC1 |
| InChI | InChI=1S/C18H26N4O3/c1-2-25-17-14(5-3-9-20-17)18(24)21-11-7-13(8-12-21)22-10-4-6-15(22)16(19)23/h3,5,9,13,15H,2,4,6-8,10-12H2,1H3,(H2,19,23)/t15-/m1/s1 |
| InChIKey | OFCWWJWQCVBPOK-OAHLLOKOSA-N |
| XLogP | 1.03 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |