C16H26N4O4 — CID 95150690
N-cyclohexyl-4-[[(1S,2R)-2-nitrocyclopropanecarbonyl]amino]piperidine-1-carboxamide (PubChem CID 95150690) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-cyclohexyl-4-[[(1S,2R)-2-nitrocyclopropanecarbonyl]amino]piperidine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[[(1S,2R)-2-nitrocyclopropanecarbonyl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95150690 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-cyclohexyl-4-[[(1S,2R)-2-nitrocyclopropanecarbonyl]amino]piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)NC2CCCCC2)CC1)[C@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C16H26N4O4/c21-15(13-10-14(13)20(23)24)17-12-6-8-19(9-7-12)16(22)18-11-4-2-1-3-5-11/h11-14H,1-10H2,(H,17,21)(H,18,22)/t13-,14+/m0/s1 |
| InChIKey | PJIFWEBDNBSELU-UONOGXRCSA-N |
| XLogP | 1.27 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|