C15H26N4O2S — CID 95158154
N-[3-[(3R)-3-[[(5-methyl-2-pyridinyl)amino]methyl]pyrrolidin-1-yl]propyl]methanesulfonamide (PubChem CID 95158154) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is N-[3-[(3R)-3-[[(5-methyl-2-pyridinyl)amino]methyl]pyrrolidin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[(3R)-3-[[(5-methyl-2-pyridinyl)amino]methyl]pyrrolidin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 95158154 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-[3-[(3R)-3-[[(5-methyl-2-pyridinyl)amino]methyl]pyrrolidin-1-yl]propyl]methanesulfonamide |
| SMILES | Cc1ccc(NC[C@H]2CCN(CCCNS(C)(=O)=O)C2)nc1 |
| InChI | InChI=1S/C15H26N4O2S/c1-13-4-5-15(16-10-13)17-11-14-6-9-19(12-14)8-3-7-18-22(2,20)21/h4-5,10,14,18H,3,6-9,11-12H2,1-2H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | DXPSVIMAEDNFPG-CQSZACIVSA-N |
| XLogP | 1.06 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|