C14H24N4O2S — CID 97119107
N-methyl-6-[[(3S)-1-propylpyrrolidin-3-yl]methylamino]pyridine-3-sulfonamide (PubChem CID 97119107) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-methyl-6-[[(3S)-1-propylpyrrolidin-3-yl]methylamino]pyridine-3-sulfonamide.
| Compound Name | N-methyl-6-[[(3S)-1-propylpyrrolidin-3-yl]methylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 97119107 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-methyl-6-[[(3S)-1-propylpyrrolidin-3-yl]methylamino]pyridine-3-sulfonamide |
| SMILES | CCCN1CC[C@@H](CNc2ccc(S(=O)(=O)NC)cn2)C1 |
| InChI | InChI=1S/C14H24N4O2S/c1-3-7-18-8-6-12(11-18)9-16-14-5-4-13(10-17-14)21(19,20)15-2/h4-5,10,12,15H,3,6-9,11H2,1-2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | IFBNMASUGWCJPX-LBPRGKRZSA-N |
| XLogP | 1.13 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |