C19H20N2O3 — CID 95160182
3-[[2-[(2S)-2-methylpiperidine-1-carbonyl]furan-3-yl]methoxy]benzonitrile (PubChem CID 95160182) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[[2-[(2S)-2-methylpiperidine-1-carbonyl]furan-3-yl]methoxy]benzonitrile.
| Compound Name | 3-[[2-[(2S)-2-methylpiperidine-1-carbonyl]furan-3-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 95160182 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[[2-[(2S)-2-methylpiperidine-1-carbonyl]furan-3-yl]methoxy]benzonitrile |
| SMILES | C[C@H]1CCCCN1C(=O)c1occc1COc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-14-5-2-3-9-21(14)19(22)18-16(8-10-23-18)13-24-17-7-4-6-15(11-17)12-20/h4,6-8,10-11,14H,2-3,5,9,13H2,1H3/t14-/m0/s1 |
| InChIKey | VWQMNHROIFIWOU-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |