C20H24N2O3 — CID 95590071
[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[3-(phenoxymethyl)furan-2-yl]methanone (PubChem CID 95590071) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[3-(phenoxymethyl)furan-2-yl]methanone.
| Compound Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[3-(phenoxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 95590071 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[3-(phenoxymethyl)furan-2-yl]methanone |
| SMILES | O=C(c1occc1COc1ccccc1)N1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C20H24N2O3/c23-20(22-12-11-21-10-5-4-6-17(21)14-22)19-16(9-13-24-19)15-25-18-7-2-1-3-8-18/h1-3,7-9,13,17H,4-6,10-12,14-15H2/t17-/m1/s1 |
| InChIKey | UHMYMYPMTLVWEB-QGZVFWFLSA-N |
| XLogP | 3.17 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |