C17H20N2O3 — CID 119486321
[3-(aminomethyl)pyrrolidin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone (PubChem CID 119486321) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 119486321 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone |
| SMILES | NCC1CCN(C(=O)c2occc2COc2ccccc2)C1 |
| InChI | InChI=1S/C17H20N2O3/c18-10-13-6-8-19(11-13)17(20)16-14(7-9-21-16)12-22-15-4-2-1-3-5-15/h1-5,7,9,13H,6,8,10-12,18H2 |
| InChIKey | YQDGUBPQGNTBJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |