C20H25N3O5S — CID 30832889
[3-(phenoxymethyl)furan-2-yl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 30832889) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is [3-(phenoxymethyl)furan-2-yl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [3-(phenoxymethyl)furan-2-yl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 30832889 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [3-(phenoxymethyl)furan-2-yl]-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1occc1COc1ccccc1)N1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H25N3O5S/c24-20(19-17(8-15-27-19)16-28-18-6-2-1-3-7-18)21-11-13-23(14-12-21)29(25,26)22-9-4-5-10-22/h1-3,6-8,15H,4-5,9-14,16H2 |
| InChIKey | SSCXYJMIEKNUHZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |