C23H24N2O3 — CID 41430741
[4-(3-methylphenyl)piperazin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone (PubChem CID 41430741) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is [4-(3-methylphenyl)piperazin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone.
| Compound Name | [4-(3-methylphenyl)piperazin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 41430741 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [4-(3-methylphenyl)piperazin-1-yl]-[3-(phenoxymethyl)furan-2-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3occc3COc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-18-6-5-7-20(16-18)24-11-13-25(14-12-24)23(26)22-19(10-15-27-22)17-28-21-8-3-2-4-9-21/h2-10,15-16H,11-14,17H2,1H3 |
| InChIKey | SMRHCVPDXQRABT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |