C22H26N2O5 — CID 43064177
morpholin-4-yl-[1-[3-(phenoxymethyl)furan-2-carbonyl]piperidin-3-yl]methanone (PubChem CID 43064177) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is morpholin-4-yl-[1-[3-(phenoxymethyl)furan-2-carbonyl]piperidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-[3-(phenoxymethyl)furan-2-carbonyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 43064177 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | morpholin-4-yl-[1-[3-(phenoxymethyl)furan-2-carbonyl]piperidin-3-yl]methanone |
| SMILES | O=C(c1occc1COc1ccccc1)N1CCCC(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C22H26N2O5/c25-21(23-10-13-27-14-11-23)17-5-4-9-24(15-17)22(26)20-18(8-12-28-20)16-29-19-6-2-1-3-7-19/h1-3,6-8,12,17H,4-5,9-11,13-16H2 |
| InChIKey | KISCJDLFIAGQLG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |