C19H22N4O2 — CID 95161150
2-[(5-cyano-2-pyridinyl)-methylamino]-N-[(2R)-1-(4-methylphenoxy)propan-2-yl]acetamide (PubChem CID 95161150) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[(5-cyano-2-pyridinyl)-methylamino]-N-[(2R)-1-(4-methylphenoxy)propan-2-yl]acetamide.
| Compound Name | 2-[(5-cyano-2-pyridinyl)-methylamino]-N-[(2R)-1-(4-methylphenoxy)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 95161150 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[(5-cyano-2-pyridinyl)-methylamino]-N-[(2R)-1-(4-methylphenoxy)propan-2-yl]acetamide |
| SMILES | Cc1ccc(OC[C@@H](C)NC(=O)CN(C)c2ccc(C#N)cn2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-4-7-17(8-5-14)25-13-15(2)22-19(24)12-23(3)18-9-6-16(10-20)11-21-18/h4-9,11,15H,12-13H2,1-3H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | QKPWMTMILOXIOJ-OAHLLOKOSA-N |
| XLogP | 2.28 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |