C15H16N4O2S — CID 71861276
2-[(5-cyano-2-pyridinyl)-methylamino]-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide (PubChem CID 71861276) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[(5-cyano-2-pyridinyl)-methylamino]-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-[(5-cyano-2-pyridinyl)-methylamino]-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 71861276 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[(5-cyano-2-pyridinyl)-methylamino]-N-(2-hydroxy-2-thiophen-3-ylethyl)acetamide |
| SMILES | CN(CC(=O)NCC(O)c1ccsc1)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C15H16N4O2S/c1-19(14-3-2-11(6-16)7-17-14)9-15(21)18-8-13(20)12-4-5-22-10-12/h2-5,7,10,13,20H,8-9H2,1H3,(H,18,21) |
| InChIKey | CGQICMCUOIVEEC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |