C17H23N3O4 — CID 95166323
2-[(4S)-4-(methoxymethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 95166323) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[(4S)-4-(methoxymethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-[(4S)-4-(methoxymethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 95166323 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[(4S)-4-(methoxymethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | COC[C@]1(C)NC(=O)N(CC(=O)N(c2ccccc2)C(C)C)C1=O |
| InChI | InChI=1S/C17H23N3O4/c1-12(2)20(13-8-6-5-7-9-13)14(21)10-19-15(22)17(3,11-24-4)18-16(19)23/h5-9,12H,10-11H2,1-4H3,(H,18,23)/t17-/m0/s1 |
| InChIKey | XKQBKIBTNHRTIZ-KRWDZBQOSA-N |
| XLogP | 1.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|