C17H24N2 — CID 95172612
4-[propyl-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butanenitrile (PubChem CID 95172612) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[propyl-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butanenitrile.
| Compound Name | 4-[propyl-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butanenitrile |
|---|---|
| PubChem CID | 95172612 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-[propyl-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butanenitrile |
| SMILES | CCCN(CCCC#N)[C@@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H24N2/c1-2-12-19(13-6-5-11-18)17-10-9-15-7-3-4-8-16(15)14-17/h3-4,7-8,17H,2,5-6,9-10,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | TXCNXNFFLWPECX-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|