C17H25N3O2S — CID 95175650
(3R)-N-[(3S)-3-cyanothiolan-3-yl]-1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 95175650) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is (3R)-N-[(3S)-3-cyanothiolan-3-yl]-1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(3S)-3-cyanothiolan-3-yl]-1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95175650 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3R)-N-[(3S)-3-cyanothiolan-3-yl]-1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CCC(N2C[C@H](C(=O)N[C@]3(C#N)CCSC3)CC2=O)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-12-2-4-14(5-3-12)20-9-13(8-15(20)21)16(22)19-17(10-18)6-7-23-11-17/h12-14H,2-9,11H2,1H3,(H,19,22)/t12?,13-,14?,17+/m1/s1 |
| InChIKey | DNOYWIANHHCCCL-GMUWMPNVSA-N |
| XLogP | 1.93 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |