C18H30N2O4 — CID 119203994
4-methyl-4-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid (PubChem CID 119203994) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-methyl-4-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119203994 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 4-methyl-4-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
| SMILES | CC1CCC(N2CC(C(=O)NC(C)(C)CCC(=O)O)CC2=O)CC1 |
| InChI | InChI=1S/C18H30N2O4/c1-12-4-6-14(7-5-12)20-11-13(10-15(20)21)17(24)19-18(2,3)9-8-16(22)23/h12-14H,4-11H2,1-3H3,(H,19,24)(H,22,23) |
| InChIKey | ZVYUEYIGXCVTQA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |