C15H27N3O4 — CID 119357531
4-[[1-[2-(dimethylamino)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119357531) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[[1-[2-(dimethylamino)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[1-[2-(dimethylamino)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357531 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-[[1-[2-(dimethylamino)ethyl]-5-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CN(C)CCN1CC(C(=O)NC(C)(C)CCC(=O)O)CC1=O |
| InChI | InChI=1S/C15H27N3O4/c1-15(2,6-5-13(20)21)16-14(22)11-9-12(19)18(10-11)8-7-17(3)4/h11H,5-10H2,1-4H3,(H,16,22)(H,20,21) |
| InChIKey | QMSCDQHHDCCZFN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |