C17H16FN3O2S — CID 95176032
4-fluoro-N-[(4-imidazol-1-ylphenyl)methyl]-2-methylbenzenesulfonamide (PubChem CID 95176032) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-fluoro-N-[(4-imidazol-1-ylphenyl)methyl]-2-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[(4-imidazol-1-ylphenyl)methyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 95176032 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4-fluoro-N-[(4-imidazol-1-ylphenyl)methyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-13-10-15(18)4-7-17(13)24(22,23)20-11-14-2-5-16(6-3-14)21-9-8-19-12-21/h2-10,12,20H,11H2,1H3 |
| InChIKey | PHTJMWIUGGLFQO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |