C15H17N3O2S2 — CID 95186361
4-amino-N-[[(3R)-oxolan-3-yl]methyl]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 95186361) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-amino-N-[[(3R)-oxolan-3-yl]methyl]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[[(3R)-oxolan-3-yl]methyl]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 95186361 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-amino-N-[[(3R)-oxolan-3-yl]methyl]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | Nc1c(C(=O)NC[C@H]2CCOC2)sc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C15H17N3O2S2/c16-13-12(14(19)17-8-10-6-7-20-9-10)22-15(21)18(13)11-4-2-1-3-5-11/h1-5,10H,6-9,16H2,(H,17,19)/t10-/m1/s1 |
| InChIKey | CVSZFYNKEOTFBC-SNVBAGLBSA-N |
| XLogP | 2.62 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|