C15H21FN2O2S — CID 95188008
N-[[(3R)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]methyl]methanesulfonamide (PubChem CID 95188008) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[[(3R)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3R)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 95188008 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[[(3R)-1-[(E)-3-(4-fluorophenyl)prop-2-enyl]pyrrolidin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@H]1CCN(C/C=C/c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H21FN2O2S/c1-21(19,20)17-11-14-8-10-18(12-14)9-2-3-13-4-6-15(16)7-5-13/h2-7,14,17H,8-12H2,1H3/b3-2+/t14-/m0/s1 |
| InChIKey | BNPPZSVYDOOAJF-HSWBROFVSA-N |
| XLogP | 1.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |