C16H21N3O4 — CID 95191354
N-[(2S)-2-hydroxybutyl]-5-[(2-methoxyphenoxy)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 95191354) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[(2S)-2-hydroxybutyl]-5-[(2-methoxyphenoxy)methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-2-hydroxybutyl]-5-[(2-methoxyphenoxy)methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95191354 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[(2S)-2-hydroxybutyl]-5-[(2-methoxyphenoxy)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | CC[C@H](O)CNC(=O)c1cc(COc2ccccc2OC)[nH]n1 |
| InChI | InChI=1S/C16H21N3O4/c1-3-12(20)9-17-16(21)13-8-11(18-19-13)10-23-15-7-5-4-6-14(15)22-2/h4-8,12,20H,3,9-10H2,1-2H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChIKey | BIYODYWWBQASOG-LBPRGKRZSA-N |
| XLogP | 1.50 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |