C17H24N2O2 — CID 95195109
(2S)-1-[(4-methoxy-3-prop-2-enylphenyl)methyl]-2-methyl-1,4-diazepan-5-one (PubChem CID 95195109) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2S)-1-[(4-methoxy-3-prop-2-enylphenyl)methyl]-2-methyl-1,4-diazepan-5-one.
| Compound Name | (2S)-1-[(4-methoxy-3-prop-2-enylphenyl)methyl]-2-methyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95195109 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2S)-1-[(4-methoxy-3-prop-2-enylphenyl)methyl]-2-methyl-1,4-diazepan-5-one |
| SMILES | C=CCc1cc(CN2CCC(=O)NC[C@@H]2C)ccc1OC |
| InChI | InChI=1S/C17H24N2O2/c1-4-5-15-10-14(6-7-16(15)21-3)12-19-9-8-17(20)18-11-13(19)2/h4,6-7,10,13H,1,5,8-9,11-12H2,2-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | HJFREICFHZQFTI-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|